

Name pH Concentration SMILES
Sodium acetate trihydrate 5.0 0.1 M [Na+].[O-]C(=O)C.O.O.O
Calcium chloride dihydrate 5.0 0.1 M [Ca+2].[Cl-].[Cl-].O.O
PEG 8000 5.0 40.0 % (w/v) C(CO)OC(CO)OC(CO)OC(CO)OC…