xtuition

4_C0593

Name pH Concentration SMILES
MOPS 7.0 0.1 M O=S(=O)(O)CCCN1CCOCC1
Rubidium chloride 7.0 0.1 M [Rb+].[Cl-]
PEG 4000 7.0 20.0 % (w/v) C(CO)OC(CO)OC(CO)OC(CO)OC…