xtuition

4_C0403

Name pH Concentration SMILES
CAPS 10.0 0.1 M O=S(=O)(O)CCCNC1CCCCC1
Ammonium sulfate 10.0 0.1 M O=S(=O)(O)O.N.N
PEG 8000 10.0 20.0 % (w/v) C(CO)OC(CO)OC(CO)OC(CO)OC…