xtuition

4_C0343

Name pH Concentration SMILES
Tris 8.0 0.1 M OCC(N)(CO)CO
Potassium chloride 8.0 0.1 M [Cl-].[K+]
PEG 20000 8.0 40.0 % (w/v) C(CO)OC(CO)OC(CO)OC(CO)OC…