xtuition

4_C0255

Name pH Concentration SMILES
TAPS 9.0 0.1 M O=S(=O)(O)CCCNC(CO)(CO)CO
Lithium chloride 9.0 0.1 M [Li+].[Cl-]
PEG 20000 9.0 20.0 % (w/v) C(CO)OC(CO)OC(CO)OC(CO)OC…