xtuition

4_C0473

Name pH Concentration SMILES
Tris 8.0 0.1 M OCC(N)(CO)CO
Ammonium chloride 8.0 0.1 M [Cl-].[NH4+]
PEG 8000 8.0 40.0 % (w/v) C(CO)OC(CO)OC(CO)OC(CO)OC…