xtuition

7_C0779

Name pH Concentration SMILES
Tris 8.0 0.1 M OCC(N)(CO)CO
Ammonium sulfate 8.0 0.1 M O=S(=O)(O)O.N.N
PEG 1000 8.0 40.0 % (w/v) C(CO)OC(CO)OC(CO)OC(CO)OC…