xtuition

7_C0485

Name pH Concentration SMILES
MES hydrate 6.0 0.1 M O=S(=O)(O)CCN1CCOCC1
Calcium chloride dihydrate 6.0 0.1 M [Ca+2].[Cl-].[Cl-].O.O
PEG 8000 6.0 40.0 % (w/v) C(CO)OC(CO)OC(CO)OC(CO)OC…