xtuition

7_C0684

Name pH Concentration SMILES
TAPS 9.0 0.1 M O=S(=O)(O)CCCNC(CO)(CO)CO
Ammonium thiocyanate 9.0 0.1 M [S-]C#N.[NH4+]
PEG 4000 9.0 40.0 % (w/v) C(CO)OC(CO)OC(CO)OC(CO)OC…