xtuition

7_C1453

Name pH Concentration SMILES
Sodium chloride 7.0 3.2 M [Na+].[Cl-]
Bis-Tris Propane 7.0 0.1 M OCC(NCCCNC(CO)(CO)CO)(CO)…