xtuition

7_C0036

Name pH Concentration SMILES
TAPS 9.0 0.1 M O=S(=O)(O)CCCNC(CO)(CO)CO
Ammonium phosphate dibasic 9.0 1.1 M [O-]P([O-])(=O)O.[NH4+].[…