xtuition

7_C0697

Name pH Concentration SMILES
Sodium acetate trihydrate 5.0 0.1 M [Na+].[O-]C(=O)C.O.O.O
Ammonium chloride 5.0 0.1 M [Cl-].[NH4+]
PEG 1000 5.0 20.0 % (w/v) C(CO)OC(CO)OC(CO)OC(CO)OC…