xtuition

7_C0707

Name pH Concentration SMILES
MES hydrate 6.0 0.1 M O=S(=O)(O)CCN1CCOCC1
Ammonium sulfate 6.0 0.1 M O=S(=O)(O)O.N.N
PEG 1000 6.0 20.0 % (w/v) C(CO)OC(CO)OC(CO)OC(CO)OC…