xtuition

7_C0139

Name pH Concentration SMILES
TAPS 9.0 0.1 M O=S(=O)(O)CCCNC(CO)(CO)CO
Potassium phosphate monobasic 9.0 0.4 M [K+].[O-]P(=O)(O)O