xtuition

7_C1484

Name pH Concentration SMILES
Sodium nitrate 7.0 1.5 M [Na+].[O-][N+]([O-])=O
Bis-Tris Propane 7.0 0.1 M OCC(NCCCNC(CO)(CO)CO)(CO)…