xtuition

7_C0242

Name pH Concentration SMILES
MES hydrate 6.0 0.1 M O=S(=O)(O)CCN1CCOCC1
Ammonium chloride 6.0 0.1 M [Cl-].[NH4+]
PEG 20000 6.0 20.0 % (w/v) C(CO)OC(CO)OC(CO)OC(CO)OC…