xtuition

7_C0359

Name pH Concentration SMILES
Tris 8.0 0.1 M OCC(N)(CO)CO
Sodium chloride 8.0 0.1 M [Na+].[Cl-]
PEG 20000 8.0 40.0 % (w/v) C(CO)OC(CO)OC(CO)OC(CO)OC…