xtuition

7_C0733

Name pH Concentration SMILES
CAPS 10.0 0.1 M O=S(=O)(O)CCCNC1CCCCC1
Potassium thiocyanate 10.0 0.1 M C(#N)[S-].[K+]
PEG 1000 10.0 20.0 % (w/v) C(CO)OC(CO)OC(CO)OC(CO)OC…