xtuition

7_C0858

Name pH Concentration SMILES
Tris 8.0 0.1 M OCC(N)(CO)CO
Lithium bromide 8.0 0.1 M [Li+].[Br-]
PEG 400 8.0 40.0 % (v/v) C(CO)OC(CO)OC(CO)OC(CO)OC…