xtuition

7_C0476

Name pH Concentration SMILES
MOPS 7.0 0.1 M O=S(=O)(O)CCCN1CCOCC1
Ammonium nitrate 7.0 0.1 M [O-][N+]([O-])=O.[NH4+]
PEG 8000 7.0 40.0 % (w/v) C(CO)OC(CO)OC(CO)OC(CO)OC…