xtuition

7_C0566

Name pH Concentration SMILES
CAPS 10.0 0.1 M O=S(=O)(O)CCCNC1CCCCC1
Lithium chloride 10.0 0.1 M [Li+].[Cl-]
PEG 4000 10.0 20.0 % (w/v) C(CO)OC(CO)OC(CO)OC(CO)OC…