| Read Date | 2008-01-11 07:55:00 |
|---|---|
| Read Number | X0000095881301200801110755 |
| Week | 0 |
| Verified Crystal | |
| 3-Way Classifier | crystal |
| 10-Way Classifier | crystal |
| Cocktail | 8_C0554 |
| Screen | HWI Generation 8 |
| Name | pH | Concentration | SMILES |
|---|---|---|---|
| Ammonium phosphate monobasic | 7.0 | 0.1 M | [O-]P(=O)(O)O.[NH4+] |
| PEG 4000 | 7.0 | 20.0 % (w/v) | C(CO)OC(CO)OC(CO)OC(CO)OC… |
| Bis-Tris Propane | 7.0 | 0.1 M | OCC(NCCCNC(CO)(CO)CO)(CO)… |
![]() | VfR122 |
|---|---|
| Spine Status | HSQC collected |
| Length | 188 aa |
| Mass | 20.63 kD |
| ext | 8940 |
| pI | 4.97 |
| Name | Protein translation elongation factor P (EF-P) |
| Database References | NCBI UniProt |
| PFAM | PF09285 |
| PDB Structures | 1YBY (Best Match) |
| Gene | |
|---|---|
| Organism | Vibrio fischeri |
| Genus | Vibrio |
| Species | fischeri |
| Strain | |
| Sequence | MPKASDIKKGSAIEHNGKVFFVKEISKLTPSGRAGATLFRMRMYDVATGAKSDESFKADDMINLADFSRRSATFSYVDGNEYVFMDSEDYTPYNFNKEAIEEELLFITEETQGLQILIVDGAPVAIELPSAVDLEIVETAPSIKGASASARTKPATMTTGLTVQVPEYIANGEKVKINTTEHKFMSRA |