| Read Date | 2008-02-15 11:14:00 |
|---|---|
| Read Number | X0000097301209200802151114 |
| Week | 0 |
| Verified Crystal | |
| 3-Way Classifier | crystal |
| 10-Way Classifier | crystal |
| Cocktail | 8_C0459 |
| Screen | HWI Generation 8 |
| Name | pH | Concentration | SMILES |
|---|---|---|---|
| Tris | 8.0 | 0.1 M | OCC(N)(CO)CO |
| Ammonium thiocyanate | 8.0 | 0.1 M | [S-]C#N.[NH4+] |
| PEG 8000 | 8.0 | 20.0 % (w/v) | C(CO)OC(CO)OC(CO)OC(CO)OC… |
![]() | CpR95 |
|---|---|
| Spine Status | HSQC collected and crystal hits |
| Length | 165 aa |
| Mass | 19.24 kD |
| ext | 22920 |
| pI | 4.63 |
| Name | Probable 16S rRNA-processing protein rimM |
| Database References | NCBI UniProt |
| PFAM | PF01782 |
| PDB Structures | 3H9N (Best Match) |
| Gene | |
|---|---|
| Organism | Clostridium perfringens |
| Genus | Clostridium |
| Species | perfringens |
| Strain | |
| Sequence | MEDLLVVGQIINTHGLRGEMKVMPLTEDMRRFDYLEYVILKGKKVKVEGVKYFKDKVILKLEGINSIEEAEKLKRTYLEIEREDAIELEEDEYFIVDLVGCTVVDTEGFEYGKIKDVIQTPSNDVYWVQGKKEVLVPVLKDIVLDINMDEKLITIRPSGEWQYED |