| Read Date | 2008-04-17 11:48:00 |
|---|---|
| Read Number | X0000098151355200804171148 |
| Week | 0 |
| Verified Crystal | |
| 3-Way Classifier | crystal |
| 10-Way Classifier | clear |
| Cocktail | 8_C0279 |
| Screen | HWI Generation 8 |
| Name | pH | Concentration | SMILES |
|---|---|---|---|
| Tris | 8.0 | 0.1 M | OCC(N)(CO)CO |
| Potassium nitrate | 8.0 | 0.1 M | [K+].[O-][N+]([O-])=O |
| PEG 20000 | 8.0 | 20.0 % (w/v) | C(CO)OC(CO)OC(CO)OC(CO)OC… |
![]() | SmR76B |
|---|---|
| Spine Status | HSQC collected and crystal hits |
| Length | 114 aa |
| Mass | 12.07 kD |
| ext | 5500 |
| pI | 8.69 |
| Name | Putative phenylalanyl-tRNA synthetase, beta subunit |
| Database References | NCBI UniProt |
| PFAM | PF01588 |
| PDB Structures | 3BU2 (Best Match) |
| Gene | |
|---|---|
| Organism | Streptococcus mutans |
| Genus | Streptococcus |
| Species | mutans |
| Strain | |
| Sequence | AKFVVGEIVEMVAHPDSDHLNICQVKIAEDKTVQIVAGAPNARVGLKTIVALPGAMMPSGGLIFPGNLRGEKSFGMLCSPRELALPKAPQKRGIIELSTDAVIGQAFDAGKHWK |