| Read Date | 2008-04-24 10:27:00 |
|---|---|
| Read Number | X0000098201445200804241027 |
| Week | 0 |
| Verified Crystal | |
| 3-Way Classifier | crystal |
| 10-Way Classifier | crystal |
| Cocktail | 8_C0182 |
| Screen | HWI Generation 8 |
| Name | pH | Concentration | SMILES |
|---|---|---|---|
| Sodium phosphate monobasic | 7.0 | 3.3 M | [Na+].[O-]P(=O)(O)O |
| Bis-Tris Propane | 7.0 | 0.1 M | OCC(NCCCNC(CO)(CO)CO)(CO)… |
![]() | HR2951 |
|---|---|
| Spine Status | HSQC collected |
| Length | 252 aa |
| Mass | 28.11 kD |
| ext | 18450 |
| pI | 8.91 |
| Name | RecName: Full=Origin recognition complex subunit 6; |
| Database References | NCBI UniProt |
| PFAM | PF05460 |
| PDB Structures | 3M03 (Best Match) |
| Gene | |
|---|---|
| Organism | Homo sapiens |
| Genus | Homo |
| Species | sapiens |
| Strain | |
| Sequence | MGSELIGRLAPRLGLAEPDMLRKAEEYLRLSRVKCVGLSARTTETSSAVMCLDLAASWMKCPLDRAYLIKLSGLNKETYQSCLKSFECLLGLNSNIGIRDLAVQFSCIEAVNMASKILKSYESSLPQTQQVDLDLSRPLFTSAALLSACKILKLKVDKNKMVATSGVKKAIFDRLCKQLEKIGQQVDREPGDVATPPRKRKKIVVEAPAKEMEKVEEMPHKPQKDEDLTQDYEEWKRKILENAASAQKATAE |