| Read Date | 2008-05-23 09:53:00 |
|---|---|
| Read Number | X0000099971304200805230953 |
| Week | 0 |
| Verified Crystal | |
| 3-Way Classifier | crystal |
| 10-Way Classifier | crystal |
| Cocktail | 8A_C1514 |
| Screen | HWI Generation 8A |
| Name | pH | Concentration | SMILES |
|---|---|---|---|
| Magnesium sulfate heptahydrate | 7.0 | 1.0 M | [Mg+2].[O-]S([O-])(=O)=O.… |
| Bis-Tris Propane | 7.0 | 0.1 M | OCC(NCCCNC(CO)(CO)CO)(CO)… |
![]() | PsR293 |
|---|---|
| Spine Status | NMR and X-Ray structures |
| Length | 117 aa |
| Mass | 13.74 kD |
| ext | 25440 |
| pI | 6.97 |
| Name | Putative uncharacterized protein |
| Database References | NCBI UniProt |
| PFAM | PF04237 |
| PDB Structures | 2KFP (NMR) 3H9X (Xray) |
| Gene | |
|---|---|
| Organism | Pseudomonas syringae |
| Genus | Pseudomonas |
| Species | syringae |
| Strain | |
| Sequence | MNRQQFIDYAQKKYDTKPDHPWEKFPDYAVFRHSDNDKWYALLMDIPAEKIGINGDKRVDVIDLKVQPELVGSLRKKPGIYPAYHMNKEHWITVLLNGPLGAKEIHSLIEDSFQLTR |