| Read Date | 2008-06-24 11:32:00 |
|---|---|
| Read Number | X0000100961495200806241132 |
| Week | 0 |
| Verified Crystal | |
| 3-Way Classifier | |
| 10-Way Classifier | |
| Cocktail | 8A_C0758 |
| Screen | HWI Generation 8A |
| Name | pH | Concentration | SMILES |
|---|---|---|---|
| Potassium phosphate tribasic | 7.0 | 0.1 M | [K+].[K+].[K+].[O-]P([O-]… |
| PEG 1000 | 7.0 | 20.0 % (w/v) | C(CO)OC(CO)OC(CO)OC(CO)OC… |
| Bis-Tris Propane | 7.0 | 0.1 M | OCC(NCCCNC(CO)(CO)CO)(CO)… |
![]() | HR5544A |
|---|---|
| Spine Status | HSQC collected |
| Length | 130 aa |
| Mass | 14.81 kD |
| ext | 18450 |
| pI | 10.94 |
| Name | Forkhead box protein E1 (Thyroid transcription factor 2) (TTF-2)(Forkhead-related protein FKHL15) |
| Database References | NCBI UniProt |
| PFAM | PF00250 |
| PDB Structures | 2HDC (Best Match) |
| Gene | |
|---|---|
| Organism | Homo sapiens |
| Genus | Homo |
| Species | sapiens |
| Strain | |
| Sequence | AGAGVPGEATGRGAGGRRRKRPLQRGKPPYSYIALIAMAIAHAPERRLTLGGIYKFITERFPFYRDNPKKWQNSIRHNLTLNDCFLKIPREAGRPGKGNYWALDPNAEDMFESGSFLRRRKRFKRSDLST |