| Read Date | 2008-06-27 08:42:00 |
|---|---|
| Read Number | X0000101211402200806270842 |
| Week | 0 |
| Verified Crystal | |
| 3-Way Classifier | |
| 10-Way Classifier | |
| Cocktail | 8A_C1239 |
| Screen | HWI Generation 8A |
| Name | pH | Concentration | SMILES |
|---|---|---|---|
| Citric acid | 6.4 | 0.0 M | C(C(=O)O)C(CC(=O)O)(C(=O)… |
| PEG 3350 | 6.4 | 20.0 % (w/v) | C(CO)OC(CO)OC(CO)OC(CO)OC… |
| Bis-Tris Propane | 6.4 | 0.1 M | OCC(NCCCNC(CO)(CO)CO)(CO)… |
![]() | BuR145A |
|---|---|
| Spine Status | crystal hits |
| Length | 157 aa |
| Mass | 18.02 kD |
| ext | 8940 |
| pI | 5.18 |
| Name | FAD-binding monooxygenase, PheA/TfdB family; possible polyketidehydroxylase (EC 1.14.13.-) |
| Database References | NCBI UniProt |
| PFAM | PF01494 |
| PDB Structures | 5BRT (Best Match) |
| Gene | |
|---|---|
| Organism | Bacillus thuringiensis |
| Genus | Bacillus |
| Species | thuringiensis |
| Strain | |
| Sequence | HNIEYLLIERHLSTAIHPKAGGITFRTMELFRELGLEQRIRSTGKTLENCRGRIAVHTIAEANQEELAQMRANQYENDEKLLQKIEEISPSKQTACYQITLEEIMLQEARTLGGELSFYHELVSYEQNEQGVIATIRNRETEKESVIHCDYVIAADG |