| Read Date | 2008-07-18 08:13:00 |
|---|---|
| Read Number | X0000101991403200807180813 |
| Week | 0 |
| Verified Crystal | |
| 3-Way Classifier | |
| 10-Way Classifier | |
| Cocktail | 8A_C0663 |
| Screen | HWI Generation 8A |
| Name | pH | Concentration | SMILES |
|---|---|---|---|
| HEPES | 7.5 | 0.1 M | [O-]S(=O)(=O)CCN1CC[NH+](… |
| Rubidium chloride | 7.5 | 0.1 M | [Rb+].[Cl-] |
| PEG 4000 | 7.5 | 40.0 % (w/v) | C(CO)OC(CO)OC(CO)OC(CO)OC… |
![]() | RsR271 |
|---|---|
| Spine Status | aggregation screening |
| Length | 196 aa |
| Mass | 21.15 kD |
| ext | 26930 |
| pI | 5.45 |
| Name | Hypothetical sam (Or some other nucleotide) binding motif protein |
| Database References | NCBI UniProt |
| PFAM | PF13489 |
| PDB Structures | 3SM3 (Best Match) |
| Gene | |
|---|---|
| Organism | Ralstonia solanacearum |
| Genus | Ralstonia |
| Species | solanacearum |
| Strain | |
| Sequence | MDTQTVAAYDTLAETFAREWREQPAPDDLYALLRRMFKAGGDTVDIGCGAGREVAWLNANGYPAVGYDASAGLLEAARTQYPGLSFRRAMLPELVGIAEGAFDNVVCETVIMHLPPAQIGAAVRRLLALLRPGGTLYLSWRVTPEADQRDGRGRLYTAFDAAGVREALAGAQVLFDEVAVSQSSGKTLHRVVARQP |