| Read Date | 2008-07-18 08:39:00 |
|---|---|
| Read Number | X0000102001375200807180839 |
| Week | 0 |
| Verified Crystal | |
| 3-Way Classifier | |
| 10-Way Classifier | |
| Cocktail | 8A_C0284 |
| Screen | HWI Generation 8A |
| Name | pH | Concentration | SMILES |
|---|---|---|---|
| TAPS | 9.0 | 0.1 M | O=S(=O)(O)CCCNC(CO)(CO)CO |
| Potassium phosphate monobasic | 9.0 | 0.1 M | [K+].[O-]P(=O)(O)O |
| PEG 20000 | 9.0 | 20.0 % (w/v) | C(CO)OC(CO)OC(CO)OC(CO)OC… |
![]() | DrR162B |
|---|---|
| Spine Status | X-Ray structure |
| Length | 195 aa |
| Mass | 21.64 kD |
| ext | 19940 |
| pI | 4.88 |
| Name | Putative uncharacterized protein |
| Database References | NCBI UniProt |
| PFAM | PF07719 |
| PDB Structures | 3GW4 (Xray) |
| Gene | |
|---|---|
| Organism | Deinococcus radiodurans |
| Genus | Deinococcus |
| Species | radiodurans |
| Strain | |
| Sequence | AAFEAHDYALAERQAQALLAHPATASGARFMLGYVYAFMDRFDEARASFQALQQQAQKSGDHTAEHRALHQVGMVERMAGNWDAARRCFLEERELLASLPEDPLAASANAYEVATVALHFGDLAGARQEYEKSLVYAQQADDQVAIACAFRGLGDLAQQEKNLLEAQQHWLRARDIFAELEDSEAVNELMTRLNG |