| Read Date | 2005-11-10 09:04:00 |
|---|---|
| Read Number | X0000060761215200511100904 |
| Week | 0 |
| Verified Crystal | |
| 3-Way Classifier | |
| 10-Way Classifier | |
| Cocktail | 6_C0652 |
| Screen | HWI Generation 6 |
| Name | pH | Concentration | SMILES |
|---|---|---|---|
| TAPS | 9.0 | 0.1 M | O=S(=O)(O)CCCNC(CO)(CO)CO |
| Potassium chloride | 9.0 | 0.1 M | [Cl-].[K+] |
| PEG 4000 | 9.0 | 40.0 % (w/v) | C(CO)OC(CO)OC(CO)OC(CO)OC… |
![]() | MhR28B |
|---|---|
| Spine Status | X-Ray structure |
| Length | 102 aa |
| Mass | 11.24 kD |
| ext | 1490 |
| pI | 9.60 |
| Name | Hypothetical protein BQLF2 (Hypothetical protein GAMMAHV.ORF52) |
| Database References | NCBI UniProt |
| PFAM | PF05812 |
| PDB Structures | 2H3R (Xray) 2OA5 (Xray) |
| Gene | |
|---|---|
| Organism | Murid herpesvirus |
| Genus | Murine |
| Species | herpesvirus |
| Strain | |
| Sequence | MASKKPDKTYEEMVKEVERLKLENKTLKQKVKSSGAVSSDDSILTAAKRESIIVSSSRALGAVAMRKIEAKVRSRAAKAVTEQELTSLLQSLTLRVDVSMEE |