| Read Date | 2009-08-04 10:35:00 |
|---|---|
| Read Number | X0000112091513200908041035 |
| Week | 0 |
| Verified Crystal | |
| 3-Way Classifier | |
| 10-Way Classifier | |
| Cocktail | 9_C0571 |
| Screen | HWI Generation 9 |
| Name | pH | Concentration | SMILES |
|---|---|---|---|
| Magnesium sulfate heptahydrate | 7.0 | 0.1 M | [Mg+2].[O-]S([O-])(=O)=O.… |
| PEG 4000 | 7.0 | 20.0 % (w/v) | C(CO)OC(CO)OC(CO)OC(CO)OC… |
| Bis-Tris Propane | 7.0 | 0.1 M | OCC(NCCCNC(CO)(CO)CO)(CO)… |
![]() | LcR13B |
|---|---|
| Spine Status | crystal hits |
| Length | 196 aa |
| Mass | 21.12 kD |
| ext | 15930 |
| pI | 5.58 |
| Name | TPR repeats containing protein |
| Database References | NCBI UniProt |
| PFAM | PF00515 |
| PDB Structures | 2HYZ (Best Match) |
| Gene | |
|---|---|
| Organism | Lactobacillus casei |
| Genus | Lactobacillus |
| Species | casei |
| Strain | |
| Sequence | DSKILTMFNQGKHEEAIQAAVKAIDAAPDDPKRYAMLATMLISIKALDQAGELLAKARQLFPEDLELQYTAGLFAYAQADFAAAVSWFAKVRTDQTLKNDATYMLALSYQQAGQPTKALAFALTAHDLAPKQLDTALLAADLLMANDVFDAAARVLKPLLATEQPQVLFTYGMALSAAGKDGSHYLNKAKALDPKG |