| Read Date | 2009-08-21 10:44:00 |
|---|---|
| Read Number | X0000112881231200908211044 |
| Week | 0 |
| Verified Crystal | |
| 3-Way Classifier | |
| 10-Way Classifier | |
| Cocktail | 9_C0656 |
| Screen | HWI Generation 9 |
| Name | pH | Concentration | SMILES |
|---|---|---|---|
| Sodium citrate tribasic dihydrate | 4.2 | 0.1 M | [Na+].[Na+].[Na+].O=C([O-… |
| Potassium nitrate | 4.2 | 0.1 M | [K+].[O-][N+]([O-])=O |
| PEG 4000 | 4.2 | 40.0 % (w/v) | C(CO)OC(CO)OC(CO)OC(CO)OC… |
![]() | SmR69A |
|---|---|
| Spine Status | HSQC collected and crystal hits |
| Length | 57 aa |
| Mass | 6.61 kD |
| ext | 2980 |
| pI | 5.15 |
| Name | Putative ribosome-associated protein |
| Database References | NCBI UniProt |
| PFAM | PF02482 |
| PDB Structures | 3LYV (Best Match) |
| Gene | |
|---|---|
| Organism | Streptococcus mutans |
| Genus | Streptococcus |
| Species | mutans |
| Strain | |
| Sequence | KVVRTKNITLKPMDIEEARLQMDLLGHDFFIYTDANDNTTNVLYRREDGNLGLIEAK |