| Read Date | 2009-09-15 09:59:00 |
|---|---|
| Read Number | X0000113361251200909150959 |
| Week | 0 |
| Verified Crystal | |
| 3-Way Classifier | |
| 10-Way Classifier | |
| Cocktail | 9_C0361 |
| Screen | HWI Generation 9 |
| Name | pH | Concentration | SMILES |
|---|---|---|---|
| HEPES | 7.5 | 0.1 M | [O-]S(=O)(=O)CCN1CC[NH+](… |
| Sodium molybdate dihydrate | 7.5 | 0.1 M | [Na+].[O-]C(=O)CCCCCCC(O)… |
| PEG 20000 | 7.5 | 24.0 % (w/v) | C(CO)OC(CO)OC(CO)OC(CO)OC… |
![]() | PtR41A |
|---|---|
| Spine Status | X-Ray structure |
| Length | 107 aa |
| Mass | 11.49 kD |
| ext | 11460 |
| pI | 3.83 |
| Name | n/a |
| Database References | NCBI UniProt |
| PFAM | PF06458 |
| PDB Structures | 3LYY (Xray) |
| Gene | |
|---|---|
| Organism | Pediococcus pentosaceus |
| Genus | Pediococcus |
| Species | pentosaceus |
| Strain | |
| Sequence | THATSTETIHYVNEDGDQVFEDGGGKLDFTRTVTIDDVTNEVVEYGEWTPVTDDEFAAVTSPDKDGYTPDTSEVAAQKPDMTDGPDGTVKDVEVTVTYTANPAVATI |