| Read Date | 2005-06-02 12:20:00 |
|---|---|
| Read Number | X0000050091316200506021220 |
| Week | <nil> |
| Verified Crystal | |
| 3-Way Classifier | crystal |
| 10-Way Classifier | crystal |
| Cocktail | 5_C1517 |
| Screen | HWI Generation 5 |
| Name | pH | Concentration | SMILES |
|---|---|---|---|
| Magnesium sulfate heptahydrate | 7.0 | 1.8 M | [Mg+2].[O-]S([O-])(=O)=O.… |
| Bis-Tris Propane | 7.0 | 0.1 M | OCC(NCCCNC(CO)(CO)CO)(CO)… |
![]() | BoR26 |
|---|---|
| Spine Status | good HSQC collected and crystal hits |
| Length | 158 aa |
| Mass | 17.62 kD |
| ext | 19480 |
| pI | 9.50 |
| Name | Putative phage-related protein |
| Database References | NCBI UniProt |
| PFAM | PF08010 |
| PDB Structures | 2B3W (Best Match) |
| Gene | |
|---|---|
| Organism | Bordetella bronchiseptica |
| Genus | Bordetella |
| Species | bronchiseptica |
| Strain | |
| Sequence | MNSASRLNISSTSDDWRGLALSNFPLSPFVLDGELFASVEGFIQGIKFREDDPRRATAFLSSGWDAKHLGDTADRSGAYWGGARIRYGSAEHHQLIERAIRARIKQCEGLRRTLRATEGMTLVHDTGKPEAPHTSLPATVFCRILETLRREILARARP |