| Read Date | 2005-07-29 11:34:00 |
|---|---|
| Read Number | X0000054391340200507291134 |
| Week | 1 |
| Verified Crystal | |
| 3-Way Classifier | |
| 10-Way Classifier | |
| Cocktail | 5_C1523 |
| Screen | HWI Generation 5 |
| Name | pH | Concentration | SMILES |
|---|---|---|---|
| di-Ammonium Tartrate | 7.0 | 1.3 M | O=C([O-])C(O)C(O)C([O-])=… |
| Bis-Tris Propane | 7.0 | 0.1 M | OCC(NCCCNC(CO)(CO)CO)(CO)… |
![]() | StR64 |
|---|---|
| Spine Status | selected |
| Length | 131 aa |
| Mass | 15.41 kD |
| ext | 22460 |
| pI | 9.40 |
| Name | Transcriptional regulator of cai and fix operon |
| Database References | NCBI UniProt |
| PFAM | PF07180 |
| PDB Structures | 4KT5 (Best Match) |
| Gene | |
|---|---|
| Organism | Salmonella typhimurium |
| Genus | Salmonella |
| Species | typhimurium |
| Strain | |
| Sequence | MCEKYVERPLYLLIADWMMAENRWITAREISRQFDIEHCKAINTLSYILSEVGEIVCEVKMIPNQIAGRGCQCQRLVKVVSIDSQLYRRLNHNLQERKVSVAKAPRLSAVPPTELNREQKWQMMLSKSMRR |