| Read Date | 2005-08-01 12:44:00 |
|---|---|
| Read Number | X0000054391221200508011244 |
| Week | 2 |
| Verified Crystal | Crystal |
| 3-Way Classifier | crystal |
| 10-Way Classifier | crystal |
| Cocktail | 5_C0462 |
| Screen | HWI Generation 5 |
| Name | pH | Concentration | SMILES |
|---|---|---|---|
| Sodium acetate trihydrate | 5.0 | 0.1 M | [Na+].[O-]C(=O)C.O.O.O |
| Manganese sulfate monohydrate | 5.0 | 0.1 M | [Mn+2].[O-]S([O-])(=O)=O.… |
| PEG 8000 | 5.0 | 20.0 % (w/v) | C(CO)OC(CO)OC(CO)OC(CO)OC… |
![]() | StR64 |
|---|---|
| Spine Status | selected |
| Length | 131 aa |
| Mass | 15.41 kD |
| ext | 22460 |
| pI | 9.40 |
| Name | Transcriptional regulator of cai and fix operon |
| Database References | NCBI UniProt |
| PFAM | PF07180 |
| PDB Structures | 4KT5 (Best Match) |
| Gene | |
|---|---|
| Organism | Salmonella typhimurium |
| Genus | Salmonella |
| Species | typhimurium |
| Strain | |
| Sequence | MCEKYVERPLYLLIADWMMAENRWITAREISRQFDIEHCKAINTLSYILSEVGEIVCEVKMIPNQIAGRGCQCQRLVKVVSIDSQLYRRLNHNLQERKVSVAKAPRLSAVPPTELNREQKWQMMLSKSMRR |