| Read Date | 2007-01-19 10:10:00 |
|---|---|
| Read Number | X0000082171367200701191010 |
| Week | <nil> |
| Verified Crystal | |
| 3-Way Classifier | crystal |
| 10-Way Classifier | crystal |
| Cocktail | 7_C0282 |
| Screen | HWI Generation 7 |
| Name | pH | Concentration | SMILES |
|---|---|---|---|
| Sodium acetate trihydrate | 5.0 | 0.1 M | [Na+].[O-]C(=O)C.O.O.O |
| Potassium phosphate monobasic | 5.0 | 0.1 M | [K+].[O-]P(=O)(O)O |
| PEG 20000 | 5.0 | 20.0 % (w/v) | C(CO)OC(CO)OC(CO)OC(CO)OC… |
![]() | SR604 |
|---|---|
| Spine Status | crystal hits |
| Length | 238 aa |
| Mass | 26.98 kD |
| ext | 21890 |
| pI | 5.75 |
| Name | Endonuclease V (EC 3.1.21.7) (Deoxyinosine 3endonuclease)(Deoxyribonuclease V) (DNase V) |
| Database References | UniProt |
| PFAM | PF04493 |
| PDB Structures | 3GA2 (Best Match) |
| Gene | |
|---|---|
| Organism | Bacillus subtilis |
| Genus | Bacillus |
| Species | subtilis |
| Strain | |
| Sequence | MKVFDVHKFDMKKEQDFLQVQFNLKNRINLSPTIHPDSINTGAGVDLAYWEQDGEPYGVCCIIVIDADTKEVIEKVHSMGRISVPYVSGFLAFRELPLIIEAAKKLETEPDVFLFDGNGYLHYNHMGVATHAAFFLGKPTIGIAKTYLKIKGCDFVTPEIEVGAYTDIIIDGEVYGRALRTRRDVKPIFLSCGNYIDLDSSYQITMSLINQESRLPIPVRLADLETHVLRTFYQKNHV |