| Read Date | 2007-01-26 09:20:00 |
|---|---|
| Read Number | X0000082681212200701260920 |
| Week | 0 |
| Verified Crystal | |
| 3-Way Classifier | crystal |
| 10-Way Classifier | clear |
| Cocktail | 7_C1419 |
| Screen | HWI Generation 7 |
| Name | pH | Concentration | SMILES |
|---|---|---|---|
| Lithium sulfate monohydrate | 6.5 | 0.2 M | [Li+].[Li+].[O-]S([O-])(=… |
| Bis-Tris | 6.5 | 0.1 M | OCCN(C(CO)(CO)CO)CCO |
| PEG 3350 | 6.5 | 25.0 % (w/v) | C(CO)OC(CO)OC(CO)OC(CO)OC… |
![]() | BhR130 |
|---|---|
| Spine Status | X-Ray structure |
| Length | 215 aa |
| Mass | 24.63 kD |
| ext | 30940 |
| pI | 5.17 |
| Name | BH2835 protein |
| Database References | NCBI UniProt |
| PFAM | PF01966 |
| PDB Structures | 3DTO (Xray) |
| Gene | |
|---|---|
| Organism | Bacillus halodurans |
| Genus | Bacillus |
| Species | halodurans |
| Strain | |
| Sequence | MNEQAILQSAEAWVKKQLMDEYSGHDWYHIRRVTLMAKAIGEQEKVDVFVVQIAALFHDLIDDKLVDDPETAKQQLIDWMEAAGVPSQKIDHTMDIINTISFKGGHGQSLATREAMVVQDADRLDALGAIGIARTFAYSGNKGQPIYDPELPIRETMTVEEYRHGKSTAINHFYEKLFKLKDLMNTETGKQLAKERHVFMEQFIERFLSEWNGDM |