| Read Date | 2007-01-26 09:41:00 |
|---|---|
| Read Number | X0000082691496200701260941 |
| Week | 0 |
| Verified Crystal | |
| 3-Way Classifier | crystal |
| 10-Way Classifier | clear |
| Cocktail | 7_C1526 |
| Screen | HWI Generation 7 |
| Name | pH | Concentration | SMILES |
|---|---|---|---|
| Potassium sodium tartrate tetrahydrate | 7.0 | 1.2 M | [K+].[Na+].O=C([O-])[C@H]… |
| Bis-Tris Propane | 7.0 | 0.1 M | OCC(NCCCNC(CO)(CO)CO)(CO)… |
![]() | GmR87 |
|---|---|
| Spine Status | X-Ray structure |
| Length | 104 aa |
| Mass | 12.20 kD |
| ext | 22460 |
| pI | 5.76 |
| Name | HNH endonuclease |
| Database References | NCBI UniProt |
| PFAM | PF01844 |
| PDB Structures | 4H9D (Xray) |
| Gene | |
|---|---|
| Organism | Geobacter metallireducens |
| Genus | Geobacter |
| Species | metallireducens |
| Strain | |
| Sequence | MNYFIVEVSEQEVKREKEKARELRRSQWWKNRIARGICHYCGEIFPPEELTMDHLVPVVRGGKSTRGNVVPACKECNNRKKYLLPVEWEEYLDSLESEPSDGEG |