| Read Date | 2007-03-23 08:44:00 |
|---|---|
| Read Number | X0000086001017200703230844 |
| Week | 0 |
| Verified Crystal | |
| 3-Way Classifier | crystal |
| 10-Way Classifier | clear |
| Cocktail | 7_C0447 |
| Screen | HWI Generation 7 |
| Name | pH | Concentration | SMILES |
|---|---|---|---|
| Lithium sulfate monohydrate | 8.5 | 0.2 M | [Li+].[Li+].[O-]S([O-])(=… |
| PEG 4000 | 8.5 | 25.5 % (w/v) | C(CO)OC(CO)OC(CO)OC(CO)OC… |
| Tris HCl | 8.5 | 0.1 M | Cl.OCC(N)(CO)CO |
| Glycerol anhydrous | 8.5 | 15.0 % (v/v) | C(C(CO)O)O |
![]() | SuR32 |
|---|---|
| Spine Status | crystal hits |
| Length | 248 aa |
| Mass | 27.03 kD |
| ext | 5960 |
| pI | 5.92 |
| Name | Transcriptional repressor |
| Database References | NCBI UniProt |
| PFAM | PF00455 |
| PDB Structures | 4G4K (Best Match) |
| Gene | |
|---|---|
| Organism | Streptococcus thermophilus |
| Genus | Streptococcus |
| Species | thermophilus |
| Strain | |
| Sequence | MLKSERKQIILSQLKQDGFVTLENLTVLLSDTSESTIRRDLDELAADGKLKRVHGGAESIHGLKEEIANSQKAIRNVQEKAQLAGYAADLIKEGDVVFLEASTTNELLIPHLSNRQVTVVTNSIHHAVKLVDLGISTRIIGGKVKHSTDASIGSTALEQIRQLNFDCAFIGANGVDANYFTTPDMEEAVIKRTVIANAQKAYVLADASKLGQITYAKVAEVEKVTIITNASEEGLLKELKEKTRVIEV |