| Read Date | 2005-09-02 15:46:00 |
|---|---|
| Read Number | X0000056310184200509021546 |
| Week | 3 |
| Verified Crystal | |
| 3-Way Classifier | crystal |
| 10-Way Classifier | phase |
| Cocktail | 5_C1450 |
| Screen | HWI Generation 5 |
| Name | pH | Concentration | SMILES |
|---|---|---|---|
| Sodium chloride | 7.0 | 2.2 M | [Na+].[Cl-] |
| Bis-Tris Propane | 7.0 | 0.1 M | OCC(NCCCNC(CO)(CO)CO)(CO)… |
![]() | StR70 |
|---|---|
| Spine Status | NMR and X-Ray structures |
| Length | 134 aa |
| Mass | 15.06 kD |
| ext | 27500 |
| pI | 4.69 |
| Name | Putative thiol-disulfide isomerase and thioredoxin |
| Database References | UniProt |
| PFAM | PF07449 |
| PDB Structures | 2ES7 (Xray) 2GZP (NMR) 2JZT (NMR) |
| Gene | |
|---|---|
| Organism | Salmonella typhimurium |
| Genus | Salmonella |
| Species | typhimurium |
| Strain | |
| Sequence | MANDTPFSALWQRLLTRGWQPVEASTVDDWIKRVGDGVILLSSDPRRTPEVSDNPVMIAELLREFPQFDWQVAVADLEQSEAIGDRFNVRRFPATLVFTDGKLRGALSGIHPWAELLTLMRSIVDTPAAQETVQ |