| Read Date | 2007-05-04 11:01:00 |
|---|---|
| Read Number | X0000087700845200705041101 |
| Week | 1 |
| Verified Crystal | |
| 3-Way Classifier | |
| 10-Way Classifier | |
| Cocktail | 7_C0440 |
| Screen | HWI Generation 7 |
| Name | pH | Concentration | SMILES |
|---|---|---|---|
| MES hydrate | 6.0 | 0.1 M | O=S(=O)(O)CCN1CCOCC1 |
| Sodium nitrate | 6.0 | 0.1 M | [Na+].[O-][N+]([O-])=O |
| PEG 8000 | 6.0 | 20.0 % (w/v) | C(CO)OC(CO)OC(CO)OC(CO)OC… |
![]() | CgR42 |
|---|---|
| Spine Status | aggregation screening |
| Length | 344 aa |
| Mass | 38.27 kD |
| ext | 66920 |
| pI | 5.77 |
| Name | ATPase component of ABC transporters with duplicated ATPase domains |
| Database References | NCBI UniProt |
| PFAM | PF09949 |
| PDB Structures |
| Gene | |
|---|---|
| Organism | Corynebacterium glutamicum |
| Genus | Corynebacterium |
| Species | glutamicum |
| Strain | |
| Sequence | MAFADIVRSVENRTNAATLNWSIKNGWKPEVTGFSGYGSGRRVRVLARVLMSNPENLLVDAPSQSITQQAQRGWRQFFTIQVPNLPVTVTVGGKTVTSSTNDNGYVDLLVEDHNLDPGWHTIQIQAEGSTPAEARVLIVENTARIGLISDIDDTIMVTWLPRALLAAWNSWVLHTKTRKPVPGMNRFYEELLKDHPDAPVFYLSTGAWNTFETLQEFINKHALPDGPMLLTDWGPTPTGLFRSGQEHKKVQLRNLFIEYPDMKWILVGDDGQHDPLIYGEAVEEHPNRIAGVAIRELSPGEHVLSHGTTASLSTITTNGGQGVPVVHGRDGYELLQRYETKPFA |