| Read Date | 2007-05-11 14:07:00 |
|---|---|
| Read Number | X0000087700406200705111407 |
| Week | 2 |
| Verified Crystal | |
| 3-Way Classifier | |
| 10-Way Classifier | |
| Cocktail | 7_C0798 |
| Screen | HWI Generation 7 |
| Name | pH | Concentration | SMILES |
|---|---|---|---|
| Tris | 8.0 | 0.1 M | OCC(N)(CO)CO |
| Potassium bromide | 8.0 | 0.1 M | [K+].[Br-] |
| PEG 1000 | 8.0 | 40.0 % (w/v) | C(CO)OC(CO)OC(CO)OC(CO)OC… |
![]() | CgR42 |
|---|---|
| Spine Status | aggregation screening |
| Length | 344 aa |
| Mass | 38.27 kD |
| ext | 66920 |
| pI | 5.77 |
| Name | ATPase component of ABC transporters with duplicated ATPase domains |
| Database References | NCBI UniProt |
| PFAM | PF09949 |
| PDB Structures |
| Gene | |
|---|---|
| Organism | Corynebacterium glutamicum |
| Genus | Corynebacterium |
| Species | glutamicum |
| Strain | |
| Sequence | MAFADIVRSVENRTNAATLNWSIKNGWKPEVTGFSGYGSGRRVRVLARVLMSNPENLLVDAPSQSITQQAQRGWRQFFTIQVPNLPVTVTVGGKTVTSSTNDNGYVDLLVEDHNLDPGWHTIQIQAEGSTPAEARVLIVENTARIGLISDIDDTIMVTWLPRALLAAWNSWVLHTKTRKPVPGMNRFYEELLKDHPDAPVFYLSTGAWNTFETLQEFINKHALPDGPMLLTDWGPTPTGLFRSGQEHKKVQLRNLFIEYPDMKWILVGDDGQHDPLIYGEAVEEHPNRIAGVAIRELSPGEHVLSHGTTASLSTITTNGGQGVPVVHGRDGYELLQRYETKPFA |