| Read Date | 2007-05-11 08:38:00 |
|---|---|
| Read Number | X0000088051439200705110838 |
| Week | 0 |
| Verified Crystal | |
| 3-Way Classifier | crystal |
| 10-Way Classifier | crystal |
| Cocktail | 7_C0672 |
| Screen | HWI Generation 7 |
| Name | pH | Concentration | SMILES |
|---|---|---|---|
| TAPS | 9.0 | 0.1 M | O=S(=O)(O)CCCNC(CO)(CO)CO |
| Sodium nitrate | 9.0 | 0.1 M | [Na+].[O-][N+]([O-])=O |
| PEG 4000 | 9.0 | 40.0 % (w/v) | C(CO)OC(CO)OC(CO)OC(CO)OC… |
![]() | RpR5 |
|---|---|
| Spine Status | crystal hits |
| Length | 225 aa |
| Mass | 24.79 kD |
| ext | 14440 |
| pI | 4.70 |
| Name | NA |
| Database References | NCBI UniProt |
| PFAM | PF02190 |
| PDB Structures | 3LJC (Best Match) |
| Gene | |
|---|---|
| Organism | Rhodopseudomonas palustris |
| Genus | Rhodopseudomonas |
| Species | palustris |
| Strain | |
| Sequence | MPINAAYRGPADLPEVIPVFPLAGALLLPRGQMPLNIFEPRYLAMIDDALRDGHRLIGMIQPDAAHSSETAEKPSLFNVGCVGRITQLAESGDGRYILELTGVSRFKVVDELQVLTPYRQCKVDYFPFVDDFTARKGEDEVDRETLLSVLTDFLKANNLKVDWDGVESAPNEALVNALAMMSPYGPPEKQALLEAPDLKTRAEILIAVTEMDLAKKRTSGDPPLQ |