| Read Date | 2007-05-11 08:41:00 |
|---|---|
| Read Number | X0000088051236200705110841 |
| Week | 0 |
| Verified Crystal | |
| 3-Way Classifier | other |
| 10-Way Classifier | precip |
| Cocktail | 7_C1425 |
| Screen | HWI Generation 7 |
| Name | pH | Concentration | SMILES |
|---|---|---|---|
| Tris | 8.5 | 0.1 M | OCC(N)(CO)CO |
| Ammonium acetate | 8.5 | 0.2 M | O=C(O)C.N |
| PEG 3350 | 8.5 | 25.0 % (w/v) | C(CO)OC(CO)OC(CO)OC(CO)OC… |
![]() | RpR5 |
|---|---|
| Spine Status | crystal hits |
| Length | 225 aa |
| Mass | 24.79 kD |
| ext | 14440 |
| pI | 4.70 |
| Name | NA |
| Database References | NCBI UniProt |
| PFAM | PF02190 |
| PDB Structures | 3LJC (Best Match) |
| Gene | |
|---|---|
| Organism | Rhodopseudomonas palustris |
| Genus | Rhodopseudomonas |
| Species | palustris |
| Strain | |
| Sequence | MPINAAYRGPADLPEVIPVFPLAGALLLPRGQMPLNIFEPRYLAMIDDALRDGHRLIGMIQPDAAHSSETAEKPSLFNVGCVGRITQLAESGDGRYILELTGVSRFKVVDELQVLTPYRQCKVDYFPFVDDFTARKGEDEVDRETLLSVLTDFLKANNLKVDWDGVESAPNEALVNALAMMSPYGPPEKQALLEAPDLKTRAEILIAVTEMDLAKKRTSGDPPLQ |