| Read Date | 2007-05-22 07:23:00 |
|---|---|
| Read Number | X0000088361400200705220723 |
| Week | 0 |
| Verified Crystal | |
| 3-Way Classifier | crystal |
| 10-Way Classifier | crystal |
| Cocktail | 7_C1430 |
| Screen | HWI Generation 7 |
| Name | pH | Concentration | SMILES |
|---|---|---|---|
| Potassium sodium tartrate tetrahydrate | 7.5 | 0.2 M | [K+].[Na+].O=C([O-])[C@H]… |
| PEG 3350 | 7.5 | 20.0 % (w/v) | C(CO)OC(CO)OC(CO)OC(CO)OC… |
![]() | HR2978 |
|---|---|
| Spine Status | X-Ray structure |
| Length | 186 aa |
| Mass | 21.00 kD |
| ext | 41940 |
| pI | 5.79 |
| Name | RecName: Full=Putative hydrolase RBBP9; EC=3.-.-.-;AltName: Full=Retinoblastoma-binding protein 9; Short=RBBP-9;AltName: Full=Retinoblastoma-binding protein 10; Short=RBBP-10;AltName: Full=B5T overexpressed gene protein; Short=Protein BOG; |
| Database References | NCBI UniProt |
| PFAM | PF06821 |
| PDB Structures | 2QS9 (Xray) |
| Gene | |
|---|---|
| Organism | Homo sapiens |
| Genus | Homo |
| Species | sapiens |
| Strain | |
| Sequence | MASPSKAVIVPGNGGGDVTTHGWYGWVKKELEKIPGFQCLAKNMPDPITARESIWLPFMETELHCDEKTIIIGHSSGAIAAMRYAETHRVYAIVLVSAYTSDLGDENERASGYFTRPWQWEKIKANCPYIVQFGSTDDPFLPWKEQQEVADRLETKLHKFTDCGHFQNTEFHELITVVKSLLKVPA |