 
    | Read Date | 2007-05-22 07:26:00 | 
|---|---|
| Read Number | X0000088361245200705220726 | 
| Week | 0 | 
| Verified Crystal | |
| 3-Way Classifier | crystal | 
| 10-Way Classifier | clear | 
| Cocktail | 7_C0468 | 
| Screen | HWI Generation 7 | 
| Name | pH | Concentration | SMILES | 
|---|---|---|---|
| Ammonium bromide | 4.0 | 0.1 M | [Br-].[NH4+] | 
| Sodium citrate tribasic dihydrate | 4.0 | 0.1 M | [Na+].[Na+].[Na+].O=C([O-… | 
| PEG 8000 | 4.0 | 40.0 % (w/v) | C(CO)OC(CO)OC(CO)OC(CO)OC… | 
|  | HR2978 | 
|---|---|
| Spine Status | X-Ray structure | 
| Length | 186 aa | 
| Mass | 21.00 kD | 
| ext | 41940 | 
| pI | 5.79 | 
| Name | RecName: Full=Putative hydrolase RBBP9; EC=3.-.-.-;AltName: Full=Retinoblastoma-binding protein 9; Short=RBBP-9;AltName: Full=Retinoblastoma-binding protein 10; Short=RBBP-10;AltName: Full=B5T overexpressed gene protein; Short=Protein BOG; | 
| Database References | NCBI UniProt | 
| PFAM | PF06821 | 
| PDB Structures | 2QS9 (Xray) | 
| Gene | |
|---|---|
| Organism | Homo sapiens | 
| Genus | Homo | 
| Species | sapiens | 
| Strain | |
| Sequence | MASPSKAVIVPGNGGGDVTTHGWYGWVKKELEKIPGFQCLAKNMPDPITARESIWLPFMETELHCDEKTIIIGHSSGAIAAMRYAETHRVYAIVLVSAYTSDLGDENERASGYFTRPWQWEKIKANCPYIVQFGSTDDPFLPWKEQQEVADRLETKLHKFTDCGHFQNTEFHELITVVKSLLKVPA |