| Read Date | 2007-07-20 09:43:00 |
|---|---|
| Read Number | X0000090711344200707200943 |
| Week | 0 |
| Verified Crystal | |
| 3-Way Classifier | other |
| 10-Way Classifier | precip |
| Cocktail | 7_C1524 |
| Screen | HWI Generation 7 |
| Name | pH | Concentration | SMILES |
|---|---|---|---|
| Tris | 8.5 | 0.1 M | OCC(N)(CO)CO |
| di-Ammonium Tartrate | 8.5 | 1.4 M | O=C([O-])C(O)C(O)C([O-])=… |
![]() | ZR227 |
|---|---|
| Spine Status | HSQC collected and crystal hits |
| Length | 140 aa |
| Mass | 15.45 kD |
| ext | 2980 |
| pI | 4.81 |
| Name | Hypothetical protein MW0656 |
| Database References | NCBI UniProt |
| PFAM | PF03479 |
| PDB Structures | 3HTN (Best Match) |
| Gene | |
|---|---|
| Organism | Staphylococcus aureus |
| Genus | Staphylococcus |
| Species | aureus |
| Strain | |
| Sequence | MKLQKSNHTILLVLEKGEDIVECITTFADDQDLTFTSVSGIGACDDVVLKFFNLTTKQYEEKHITEPLELTSLLGNISRLDNGHFAHLHATFGTQSYETFSGHLAKAIVSATAEIILTVTDLDIQRSFKDAVGLNLLDPQ |