| Read Date | 2007-07-20 09:44:00 |
|---|---|
| Read Number | X0000090711205200707200944 |
| Week | 0 |
| Verified Crystal | |
| 3-Way Classifier | crystal |
| 10-Way Classifier | crystal |
| Cocktail | 7_C0458 |
| Screen | HWI Generation 7 |
| Name | pH | Concentration | SMILES |
|---|---|---|---|
| Sodium citrate tribasic dihydrate | 4.0 | 0.1 M | [Na+].[Na+].[Na+].O=C([O-… |
| Potassium phosphate tribasic | 4.0 | 0.1 M | [K+].[K+].[K+].[O-]P([O-]… |
| PEG 8000 | 4.0 | 20.0 % (w/v) | C(CO)OC(CO)OC(CO)OC(CO)OC… |
![]() | ZR227 |
|---|---|
| Spine Status | HSQC collected and crystal hits |
| Length | 140 aa |
| Mass | 15.45 kD |
| ext | 2980 |
| pI | 4.81 |
| Name | Hypothetical protein MW0656 |
| Database References | NCBI UniProt |
| PFAM | PF03479 |
| PDB Structures | 3HTN (Best Match) |
| Gene | |
|---|---|
| Organism | Staphylococcus aureus |
| Genus | Staphylococcus |
| Species | aureus |
| Strain | |
| Sequence | MKLQKSNHTILLVLEKGEDIVECITTFADDQDLTFTSVSGIGACDDVVLKFFNLTTKQYEEKHITEPLELTSLLGNISRLDNGHFAHLHATFGTQSYETFSGHLAKAIVSATAEIILTVTDLDIQRSFKDAVGLNLLDPQ |